C16H16N2S — CID 28665156
N-(1,3-benzothiazol-2-ylmethyl)-2-phenylethanamine (PubChem CID 28665156) has the molecular formula C16H16N2S and a molecular weight of 268.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-phenylethanamine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-phenylethanamine |
|---|---|
| PubChem CID | 28665156 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-phenylethanamine |
| SMILES | c1ccc(CCNCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H16N2S/c1-2-6-13(7-3-1)10-11-17-12-16-18-14-8-4-5-9-15(14)19-16/h1-9,17H,10-12H2 |
| InChIKey | WXHUQODAXADTQG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|