C18H19N3S2 — CID 9283961
1-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(2-phenylethyl)thiourea (PubChem CID 9283961) has the molecular formula C18H19N3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 9283961 |
| Molecular Formula | C18H19N3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H19N3S2/c22-18(19-12-10-14-6-2-1-3-7-14)20-13-11-17-21-15-8-4-5-9-16(15)23-17/h1-9H,10-13H2,(H2,19,20,22) |
| InChIKey | RNPWSHLRNADPLM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|