C17H16N2OS2 — CID 51207948
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-phenylsulfanylacetamide (PubChem CID 51207948) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 51207948 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H16N2OS2/c20-16(12-21-13-6-2-1-3-7-13)18-11-10-17-19-14-8-4-5-9-15(14)22-17/h1-9H,10-12H2,(H,18,20) |
| InChIKey | BOMXLUSQHVMEKO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |