C14H18N2O3S2 — CID 86832012
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-propylsulfonylacetamide (PubChem CID 86832012) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-propylsulfonylacetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-propylsulfonylacetamide |
|---|---|
| PubChem CID | 86832012 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-propylsulfonylacetamide |
| SMILES | CCCS(=O)(=O)CC(=O)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-2-9-21(18,19)10-13(17)15-8-7-14-16-11-5-3-4-6-12(11)20-14/h3-6H,2,7-10H2,1H3,(H,15,17) |
| InChIKey | JXHXUINISDYEFP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |