C16H13NO2S2 — CID 78765396
1,3-benzothiazol-2-ylmethyl 2-phenylsulfanylacetate (PubChem CID 78765396) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-phenylsulfanylacetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 78765396 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H13NO2S2/c18-16(11-20-12-6-2-1-3-7-12)19-10-15-17-13-8-4-5-9-14(13)21-15/h1-9H,10-11H2 |
| InChIKey | DCDCTRBJFACDMK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |