C17H16N2O4S2 — CID 31706891
1,3-benzothiazol-2-ylmethyl 2-(benzylsulfonylamino)acetate (PubChem CID 31706891) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(benzylsulfonylamino)acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(benzylsulfonylamino)acetate |
|---|---|
| PubChem CID | 31706891 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(benzylsulfonylamino)acetate |
| SMILES | O=C(CNS(=O)(=O)Cc1ccccc1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H16N2O4S2/c20-17(10-18-25(21,22)12-13-6-2-1-3-7-13)23-11-16-19-14-8-4-5-9-15(14)24-16/h1-9,18H,10-12H2 |
| InChIKey | PJRNYVGCHVFDPK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |