C16H11Cl2NO2S — CID 2391041
1,3-benzothiazol-2-ylmethyl 2-(2,6-dichlorophenyl)acetate (PubChem CID 2391041) has the molecular formula C16H11Cl2NO2S and a molecular weight of 352.24 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(2,6-dichlorophenyl)acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 2391041 |
| Molecular Formula | C16H11Cl2NO2S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(2,6-dichlorophenyl)acetate |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H11Cl2NO2S/c17-11-4-3-5-12(18)10(11)8-16(20)21-9-15-19-13-6-1-2-7-14(13)22-15/h1-7H,8-9H2 |
| InChIKey | ATGZMUDLLIMGCP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |