C15H11ClN2O2S — CID 104631676
1,3-benzothiazol-2-ylmethyl 3-amino-2-chlorobenzoate (PubChem CID 104631676) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-amino-2-chlorobenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 104631676 |
| Molecular Formula | C15H11ClN2O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-amino-2-chlorobenzoate |
| SMILES | Nc1cccc(C(=O)OCc2nc3ccccc3s2)c1Cl |
| InChI | InChI=1S/C15H11ClN2O2S/c16-14-9(4-3-5-10(14)17)15(19)20-8-13-18-11-6-1-2-7-12(11)21-13/h1-7H,8,17H2 |
| InChIKey | IUUJEILTKMSWDO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|