C16H14N2O2S — CID 115610554
1,3-benzothiazol-2-ylmethyl 4-amino-2-methylbenzoate (PubChem CID 115610554) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-amino-2-methylbenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 115610554 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4-amino-2-methylbenzoate |
| SMILES | Cc1cc(N)ccc1C(=O)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14N2O2S/c1-10-8-11(17)6-7-12(10)16(19)20-9-15-18-13-4-2-3-5-14(13)21-15/h2-8H,9,17H2,1H3 |
| InChIKey | SRZCLRLAAWVBBH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|