C15H9BrFNO2S — CID 8837375
1,3-benzothiazol-2-ylmethyl 2-bromo-4-fluorobenzoate (PubChem CID 8837375) has the molecular formula C15H9BrFNO2S and a molecular weight of 366.21 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-bromo-4-fluorobenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 8837375 |
| Molecular Formula | C15H9BrFNO2S |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-bromo-4-fluorobenzoate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H9BrFNO2S/c16-11-7-9(17)5-6-10(11)15(19)20-8-14-18-12-3-1-2-4-13(12)21-14/h1-7H,8H2 |
| InChIKey | ONWNSRDZOLEVAY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |