C13H9NO2S2 — CID 1243333
1,3-benzothiazol-2-ylmethyl thiophene-2-carboxylate (PubChem CID 1243333) has the molecular formula C13H9NO2S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl thiophene-2-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1243333 |
| Molecular Formula | C13H9NO2S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl thiophene-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1cccs1 |
| InChI | InChI=1S/C13H9NO2S2/c15-13(11-6-3-7-17-11)16-8-12-14-9-4-1-2-5-10(9)18-12/h1-7H,8H2 |
| InChIKey | RSQVWMYGKZSWDB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |