C23H20N2O5S2 — CID 18932243
[4-(1,3-benzothiazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl thiophene-2-carboxylate (PubChem CID 18932243) has the molecular formula C23H20N2O5S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl thiophene-2-carboxylate.
| Compound Name | [4-(1,3-benzothiazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18932243 |
| Molecular Formula | C23H20N2O5S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [4-(1,3-benzothiazol-2-ylmethoxy)-N-methoxycarbonyl-2-methylanilino]methyl thiophene-2-carboxylate |
| SMILES | COC(=O)N(COC(=O)c1cccs1)c1ccc(OCc2nc3ccccc3s2)cc1C |
| InChI | InChI=1S/C23H20N2O5S2/c1-15-12-16(29-13-21-24-17-6-3-4-7-19(17)32-21)9-10-18(15)25(23(27)28-2)14-30-22(26)20-8-5-11-31-20/h3-12H,13-14H2,1-2H3 |
| InChIKey | ITRRLDQXCCIAIT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|