C20H20N2O3S — CID 18932380
methyl N-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-prop-2-enylcarbamate (PubChem CID 18932380) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is methyl N-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-prop-2-enylcarbamate.
| Compound Name | methyl N-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 18932380 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | methyl N-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC)c1ccc(OCc2nc3ccccc3s2)cc1C |
| InChI | InChI=1S/C20H20N2O3S/c1-4-11-22(20(23)24-3)17-10-9-15(12-14(17)2)25-13-19-21-16-7-5-6-8-18(16)26-19/h4-10,12H,1,11,13H2,2-3H3 |
| InChIKey | BYHWGVAJPBGBDY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|