C19H20N2O2S — CID 139801779
1-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-ethoxyethanimine (PubChem CID 139801779) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-ethoxyethanimine.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-ethoxyethanimine |
|---|---|
| PubChem CID | 139801779 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylmethoxy)-2-methylphenyl]-N-ethoxyethanimine |
| SMILES | CCON=C(C)c1ccc(OCc2nc3ccccc3s2)cc1C |
| InChI | InChI=1S/C19H20N2O2S/c1-4-23-21-14(3)16-10-9-15(11-13(16)2)22-12-19-20-17-7-5-6-8-18(17)24-19/h5-11H,4,12H2,1-3H3 |
| InChIKey | VDMLHIDCJTYVOG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|