C17H10N2O4S2 — CID 2325189
1,3-benzothiazol-2-ylmethyl 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 2325189) has the molecular formula C17H10N2O4S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2325189 |
| Molecular Formula | C17H10N2O4S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C17H10N2O4S2/c20-17(23-9-16-18-12-3-1-2-4-14(12)25-16)15-8-10-7-11(19(21)22)5-6-13(10)24-15/h1-8H,9H2 |
| InChIKey | VPQUKZZUSSUMIU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|