C18H12N4O4S — CID 55666372
1,3-benzothiazol-2-ylmethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 55666372) has the molecular formula C18H12N4O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55666372 |
| Molecular Formula | C18H12N4O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1ccn(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C18H12N4O4S/c23-18(26-11-17-19-14-6-1-2-7-16(14)27-17)15-8-9-21(20-15)12-4-3-5-13(10-12)22(24)25/h1-10H,11H2 |
| InChIKey | RZQCQCUBWBQMED-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|