C19H14BrN3O6 — CID 55703911
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 1-(3-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 55703911) has the molecular formula C19H14BrN3O6 and a molecular weight of 460.24 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 1-(3-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 1-(3-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55703911 |
| Molecular Formula | C19H14BrN3O6 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 1-(3-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCCO2)c1ccn(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H14BrN3O6/c20-15-10-18-17(27-6-7-28-18)8-12(15)11-29-19(24)16-4-5-22(21-16)13-2-1-3-14(9-13)23(25)26/h1-5,8-10H,6-7,11H2 |
| InChIKey | ZZEMFPYSOFZQPB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|