C16H12BrNO6 — CID 9454697
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 2-nitrobenzoate (PubChem CID 9454697) has the molecular formula C16H12BrNO6 and a molecular weight of 394.18 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 2-nitrobenzoate.
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 2-nitrobenzoate |
|---|---|
| PubChem CID | 9454697 |
| Molecular Formula | C16H12BrNO6 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 2-nitrobenzoate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCCO2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12BrNO6/c17-12-8-15-14(22-5-6-23-15)7-10(12)9-24-16(19)11-3-1-2-4-13(11)18(20)21/h1-4,7-8H,5-6,9H2 |
| InChIKey | SYLQWHYINWFSTB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|