C15H9BrCl2O4 — CID 7432888
(6-bromo-1,3-benzodioxol-5-yl)methyl 2,3-dichlorobenzoate (PubChem CID 7432888) has the molecular formula C15H9BrCl2O4 and a molecular weight of 404.04 g/mol. Its IUPAC name is (6-bromo-1,3-benzodioxol-5-yl)methyl 2,3-dichlorobenzoate.
| Compound Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 7432888 |
| Molecular Formula | C15H9BrCl2O4 |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 401.91 |
| IUPAC Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 2,3-dichlorobenzoate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCO2)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H9BrCl2O4/c16-10-5-13-12(21-7-22-13)4-8(10)6-20-15(19)9-2-1-3-11(17)14(9)18/h1-5H,6-7H2 |
| InChIKey | JWPGIGJBSBMYRW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |