C17H12BrNO4 — CID 7533522
(6-bromo-1,3-benzodioxol-5-yl)methyl 1H-indole-2-carboxylate (PubChem CID 7533522) has the molecular formula C17H12BrNO4 and a molecular weight of 374.19 g/mol. Its IUPAC name is (6-bromo-1,3-benzodioxol-5-yl)methyl 1H-indole-2-carboxylate.
| Compound Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7533522 |
| Molecular Formula | C17H12BrNO4 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 1H-indole-2-carboxylate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCO2)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H12BrNO4/c18-12-7-16-15(22-9-23-16)6-11(12)8-21-17(20)14-5-10-3-1-2-4-13(10)19-14/h1-7,19H,8-9H2 |
| InChIKey | UZZZUMSLQIKVOF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |