C15H10BrClO5 — CID 7434512
(6-bromo-1,3-benzodioxol-5-yl)methyl 4-chloro-2-hydroxybenzoate (PubChem CID 7434512) has the molecular formula C15H10BrClO5 and a molecular weight of 385.60 g/mol. Its IUPAC name is (6-bromo-1,3-benzodioxol-5-yl)methyl 4-chloro-2-hydroxybenzoate.
| Compound Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7434512 |
| Molecular Formula | C15H10BrClO5 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | (6-bromo-1,3-benzodioxol-5-yl)methyl 4-chloro-2-hydroxybenzoate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCO2)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C15H10BrClO5/c16-11-5-14-13(21-7-22-14)3-8(11)6-20-15(19)10-2-1-9(17)4-12(10)18/h1-5,18H,6-7H2 |
| InChIKey | PNWAAUHHNBSHPI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |