C17H13BrO5 — CID 7966436
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-formylbenzoate (PubChem CID 7966436) has the molecular formula C17H13BrO5 and a molecular weight of 377.19 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-formylbenzoate.
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 7966436 |
| Molecular Formula | C17H13BrO5 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCc2cc3c(cc2Br)OCCO3)cc1 |
| InChI | InChI=1S/C17H13BrO5/c18-14-8-16-15(21-5-6-22-16)7-13(14)10-23-17(20)12-3-1-11(9-19)2-4-12/h1-4,7-9H,5-6,10H2 |
| InChIKey | KULSBFPEYBCDEG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|