C15H11BrO5 — CID 7786393
1,3-benzodioxol-5-ylmethyl 5-bromo-2-hydroxybenzoate (PubChem CID 7786393) has the molecular formula C15H11BrO5 and a molecular weight of 351.15 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 5-bromo-2-hydroxybenzoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7786393 |
| Molecular Formula | C15H11BrO5 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 5-bromo-2-hydroxybenzoate |
| SMILES | O=C(OCc1ccc2c(c1)OCO2)c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H11BrO5/c16-10-2-3-12(17)11(6-10)15(18)19-7-9-1-4-13-14(5-9)21-8-20-13/h1-6,17H,7-8H2 |
| InChIKey | RTSMHFKLTFEQSK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |