C20H16O6 — CID 94942522
2,3-dihydro-1,4-benzodioxin-6-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 94942522) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 94942522 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCc1ccc2c(c1)OCCO2)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C20H16O6/c21-16-10-15(19(22)14-4-2-1-3-13(14)16)20(23)26-11-12-5-6-17-18(9-12)25-8-7-24-17/h1-6,9-10,21-22H,7-8,11H2 |
| InChIKey | MAJDKOKTQFYJKQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|