C34H44O14 — CID 12501641
bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl) (E)-but-2-enedioate (PubChem CID 12501641) has the molecular formula C34H44O14 and a molecular weight of 676.71 g/mol. Its IUPAC name is bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl) (E)-but-2-enedioate.
| Compound Name | bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 12501641 |
| Molecular Formula | C34H44O14 |
| Molecular Weight | 676.71 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OCc1ccc2c(c1)OCCOCCOCCOCCO2)OCc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C34H44O14/c35-33(47-25-27-1-3-29-31(23-27)45-21-17-41-13-9-37-7-11-39-15-19-43-29)5-6-34(36)48-26-28-2-4-30-32(24-28)46-22-18-42-14-10-38-8-12-40-16-20-44-30/h1-6,23-24H,7-22,25-26H2/b6-5+ |
| InChIKey | PHKVPLHUBJKHTC-AATRIKPKSA-N |
| XLogP | 2.67 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|