C47H44O10 — CID 101402005
[24-(naphthalen-2-ylmethoxymethyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl 4-benzoylbenzoate (PubChem CID 101402005) has the molecular formula C47H44O10 and a molecular weight of 768.86 g/mol. Its IUPAC name is [24-(naphthalen-2-ylmethoxymethyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl 4-benzoylbenzoate.
| Compound Name | [24-(naphthalen-2-ylmethoxymethyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl 4-benzoylbenzoate |
|---|---|
| PubChem CID | 101402005 |
| Molecular Formula | C47H44O10 |
| Molecular Weight | 768.86 g/mol |
| Exact Mass | 768.29 |
| IUPAC Name | [24-(naphthalen-2-ylmethoxymethyl)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl 4-benzoylbenzoate |
| SMILES | O=C(OCc1ccc2c(c1)OCCOCCOc1ccc(COCc3ccc4ccccc4c3)cc1OCCOCCO2)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H44O10/c48-46(38-7-2-1-3-8-38)39-14-16-40(17-15-39)47(49)57-33-36-12-19-43-45(30-36)56-27-23-51-20-24-53-42-18-11-35(29-44(42)55-26-22-50-21-25-54-43)32-52-31-34-10-13-37-6-4-5-9-41(37)28-34/h1-19,28-30H,20-27,31-33H2 |
| InChIKey | WAMRREGCUDCKEM-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.86 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |