C33H44O12 — CID 102126332
bis(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-ylmethyl) heptanedioate (PubChem CID 102126332) has the molecular formula C33H44O12 and a molecular weight of 632.70 g/mol. Its IUPAC name is bis(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-ylmethyl) heptanedioate.
| Compound Name | bis(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-ylmethyl) heptanedioate |
|---|---|
| PubChem CID | 102126332 |
| Molecular Formula | C33H44O12 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | bis(2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-ylmethyl) heptanedioate |
| SMILES | O=C(CCCCCC(=O)OCc1ccc2c(c1)OCCOCCOCCO2)OCc1ccc2c(c1)OCCOCCOCCO2 |
| InChI | InChI=1S/C33H44O12/c34-32(44-24-26-6-8-28-30(22-26)42-20-16-38-12-10-36-14-18-40-28)4-2-1-3-5-33(35)45-25-27-7-9-29-31(23-27)43-21-17-39-13-11-37-15-19-41-29/h6-9,22-23H,1-5,10-21,24-25H2 |
| InChIKey | HFVHXNKITIJEMZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|