C32H40O14 — CID 102302863
3-O-[[24-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-ethyl propanedioate (PubChem CID 102302863) has the molecular formula C32H40O14 and a molecular weight of 648.66 g/mol. Its IUPAC name is 3-O-[[24-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-ethyl propanedioate.
| Compound Name | 3-O-[[24-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-ethyl propanedioate |
|---|---|
| PubChem CID | 102302863 |
| Molecular Formula | C32H40O14 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | 3-O-[[24-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-ethyl propanedioate |
| SMILES | CCOC(=O)CC(=O)OCc1ccc2c(c1)OCCOCCOc1ccc(COC(=O)CC(=O)OCC)cc1OCCOCCO2 |
| InChI | InChI=1S/C32H40O14/c1-3-39-29(33)19-31(35)45-21-23-5-7-25-27(17-23)43-15-11-37-10-14-42-26-8-6-24(22-46-32(36)20-30(34)40-4-2)18-28(26)44-16-12-38-9-13-41-25/h5-8,17-18H,3-4,9-16,19-22H2,1-2H3 |
| InChIKey | WRUOTYKSVPRLGD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|