C21H36O9Si — CID 101395255
triethyl 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl silicate (PubChem CID 101395255) has the molecular formula C21H36O9Si and a molecular weight of 460.60 g/mol. Its IUPAC name is triethyl 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl silicate.
| Compound Name | triethyl 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl silicate |
|---|---|
| PubChem CID | 101395255 |
| Molecular Formula | C21H36O9Si |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | triethyl 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl silicate |
| SMILES | CCO[Si](OCC)(OCC)OCc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C21H36O9Si/c1-4-27-31(28-5-2,29-6-3)30-18-19-7-8-20-21(17-19)26-16-14-24-12-10-22-9-11-23-13-15-25-20/h7-8,17H,4-6,9-16,18H2,1-3H3 |
| InChIKey | SWIAYGLADRFOHG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|