C42H64O17Si — CID 102242221
[2-[[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetyl]oxymethyl]-3-triethoxysilylpropyl] 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetate (PubChem CID 102242221) has the molecular formula C42H64O17Si and a molecular weight of 869.04 g/mol. Its IUPAC name is [2-[[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetyl]oxymethyl]-3-triethoxysilylpropyl] 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetate.
| Compound Name | [2-[[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetyl]oxymethyl]-3-triethoxysilylpropyl] 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetate |
|---|---|
| PubChem CID | 102242221 |
| Molecular Formula | C42H64O17Si |
| Molecular Weight | 869.04 g/mol |
| Exact Mass | 868.39 |
| IUPAC Name | [2-[[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetyl]oxymethyl]-3-triethoxysilylpropyl] 2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)acetate |
| SMILES | CCO[Si](CC(COC(=O)Cc1ccc2c(c1)OCCOCCOCCOCCO2)COC(=O)Cc1ccc2c(c1)OCCOCCOCCOCCO2)(OCC)OCC |
| InChI | InChI=1S/C42H64O17Si/c1-4-57-60(58-5-2,59-6-3)33-36(31-55-41(43)29-34-7-9-37-39(27-34)53-25-21-49-17-13-45-11-15-47-19-23-51-37)32-56-42(44)30-35-8-10-38-40(28-35)54-26-22-50-18-14-46-12-16-48-20-24-52-38/h7-10,27-28,36H,4-6,11-26,29-33H2,1-3H3 |
| InChIKey | DNATWFHCWPUSAQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 172.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.04 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|