C26H32O10 — CID 3590202
diethyl 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarboxylate (PubChem CID 3590202) has the molecular formula C26H32O10 and a molecular weight of 504.53 g/mol. Its IUPAC name is diethyl 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarboxylate.
| Compound Name | diethyl 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarboxylate |
|---|---|
| PubChem CID | 3590202 |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | diethyl 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,24-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)OCCOCCOc1ccc(C(=O)OCC)cc1OCCOCCO2 |
| InChI | InChI=1S/C26H32O10/c1-3-31-25(27)19-5-7-21-23(17-19)35-15-11-29-10-14-34-22-8-6-20(26(28)32-4-2)18-24(22)36-16-12-30-9-13-33-21/h5-8,17-18H,3-4,9-16H2,1-2H3 |
| InChIKey | TVGNGBGVUYMDHO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |