C13H14O5 — CID 55324018
2-oxopropyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 55324018) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-oxopropyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | 2-oxopropyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 55324018 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-oxopropyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | CC(=O)COC(=O)Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H14O5/c1-9(14)8-18-13(15)7-10-2-3-11-12(6-10)17-5-4-16-11/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | NQSKQCXWESKPTK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |