C16H16N2O5 — CID 98618660
[(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 98618660) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 98618660 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | C/C(N)=C(\C#N)C(=O)COC(=O)Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H16N2O5/c1-10(18)12(8-17)13(19)9-23-16(20)7-11-2-3-14-15(6-11)22-5-4-21-14/h2-3,6H,4-5,7,9,18H2,1H3/b12-10- |
| InChIKey | RGMZRDOHWVVWHQ-BENRWUELSA-N |
| XLogP | 0.87 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|