C30H44O10Si — CID 102398924
dimethyl-bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)silane (PubChem CID 102398924) has the molecular formula C30H44O10Si and a molecular weight of 592.76 g/mol. Its IUPAC name is dimethyl-bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)silane.
| Compound Name | dimethyl-bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)silane |
|---|---|
| PubChem CID | 102398924 |
| Molecular Formula | C30H44O10Si |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | dimethyl-bis(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)silane |
| SMILES | C[Si](C)(c1ccc2c(c1)OCCOCCOCCOCCO2)c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C30H44O10Si/c1-41(2,25-3-5-27-29(23-25)39-21-17-35-13-9-31-7-11-33-15-19-37-27)26-4-6-28-30(24-26)40-22-18-36-14-10-32-8-12-34-16-20-38-28/h3-6,23-24H,7-22H2,1-2H3 |
| InChIKey | MZNZKRLNMSGRRH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|