C19H28O5Si — CID 15831450
trimethyl-[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethynyl]silane (PubChem CID 15831450) has the molecular formula C19H28O5Si and a molecular weight of 364.51 g/mol. Its IUPAC name is trimethyl-[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethynyl]silane.
| Compound Name | trimethyl-[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethynyl]silane |
|---|---|
| PubChem CID | 15831450 |
| Molecular Formula | C19H28O5Si |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | trimethyl-[2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C19H28O5Si/c1-25(2,3)15-6-17-4-5-18-19(16-17)24-14-12-22-10-8-20-7-9-21-11-13-23-18/h4-5,16H,7-14H2,1-3H3 |
| InChIKey | RXCNVQXWGKGBSB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|