C14H18O6 — CID 176853377
4,7,10,14,17,20-hexaoxatricyclo[11.7.0.03,11]icosa-1(13),2,11-triene (PubChem CID 176853377) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4,7,10,14,17,20-hexaoxatricyclo[11.7.0.03,11]icosa-1(13),2,11-triene.
| Compound Name | 4,7,10,14,17,20-hexaoxatricyclo[11.7.0.03,11]icosa-1(13),2,11-triene |
|---|---|
| PubChem CID | 176853377 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4,7,10,14,17,20-hexaoxatricyclo[11.7.0.03,11]icosa-1(13),2,11-triene |
| SMILES | c1c2c(cc3c1OCCOCCO3)OCCOCCO2 |
| InChI | InChI=1S/C14H18O6/c1-5-17-11-9-13-14(10-12(11)18-6-2-15-1)20-8-4-16-3-7-19-13/h9-10H,1-8H2 |
| InChIKey | SYQGDOXTPGWUOK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |