C16H24O7 — CID 5251455
17,18-dimethoxy-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene (PubChem CID 5251455) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 17,18-dimethoxy-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene.
| Compound Name | 17,18-dimethoxy-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene |
|---|---|
| PubChem CID | 5251455 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 17,18-dimethoxy-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),15,17-triene |
| SMILES | COc1cc2c(cc1OC)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C16H24O7/c1-17-13-11-15-16(12-14(13)18-2)23-10-8-21-6-4-19-3-5-20-7-9-22-15/h11-12H,3-10H2,1-2H3 |
| InChIKey | XTTXPODCONKPPT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |