C27H22O5 — CID 170457038
6-[2-(3,4-dimethoxyphenyl)ethynyl]-7-[2-(4-methoxyphenyl)ethynyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 170457038) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyphenyl)ethynyl]-7-[2-(4-methoxyphenyl)ethynyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[2-(3,4-dimethoxyphenyl)ethynyl]-7-[2-(4-methoxyphenyl)ethynyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 170457038 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 6-[2-(3,4-dimethoxyphenyl)ethynyl]-7-[2-(4-methoxyphenyl)ethynyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | COc1ccc(C#Cc2cc3c(cc2C#Cc2ccc(OC)c(OC)c2)OCCO3)cc1 |
| InChI | InChI=1S/C27H22O5/c1-28-23-11-6-19(7-12-23)4-9-21-17-26-27(32-15-14-31-26)18-22(21)10-5-20-8-13-24(29-2)25(16-20)30-3/h6-8,11-13,16-18H,14-15H2,1-3H3 |
| InChIKey | DBQPALMUSONMJS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|