C19H13BrO3 — CID 170457210
5-(3-bromoprop-1-ynyl)-6-[2-(4-methoxyphenyl)ethynyl]-1,3-benzodioxole (PubChem CID 170457210) has the molecular formula C19H13BrO3 and a molecular weight of 369.21 g/mol. Its IUPAC name is 5-(3-bromoprop-1-ynyl)-6-[2-(4-methoxyphenyl)ethynyl]-1,3-benzodioxole.
| Compound Name | 5-(3-bromoprop-1-ynyl)-6-[2-(4-methoxyphenyl)ethynyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 170457210 |
| Molecular Formula | C19H13BrO3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 5-(3-bromoprop-1-ynyl)-6-[2-(4-methoxyphenyl)ethynyl]-1,3-benzodioxole |
| SMILES | COc1ccc(C#Cc2cc3c(cc2C#CCBr)OCO3)cc1 |
| InChI | InChI=1S/C19H13BrO3/c1-21-17-8-5-14(6-9-17)4-7-16-12-19-18(22-13-23-19)11-15(16)3-2-10-20/h5-6,8-9,11-12H,10,13H2,1H3 |
| InChIKey | GSUZXTMROGVHFZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|