C36H46O4Si2 — CID 101475074
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4,5-bis[2-(4-methoxyphenyl)ethynyl]phenoxy]-dimethylsilane (PubChem CID 101475074) has the molecular formula C36H46O4Si2 and a molecular weight of 598.93 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4,5-bis[2-(4-methoxyphenyl)ethynyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4,5-bis[2-(4-methoxyphenyl)ethynyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101475074 |
| Molecular Formula | C36H46O4Si2 |
| Molecular Weight | 598.93 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-4,5-bis[2-(4-methoxyphenyl)ethynyl]phenoxy]-dimethylsilane |
| SMILES | COc1ccc(C#Cc2cc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)cc2C#Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H46O4Si2/c1-35(2,3)41(9,10)39-33-25-29(19-13-27-15-21-31(37-7)22-16-27)30(20-14-28-17-23-32(38-8)24-18-28)26-34(33)40-42(11,12)36(4,5)6/h15-18,21-26H,1-12H3 |
| InChIKey | KIHMLLHYKXCBBQ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.93 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|