C22H27NO3Si — CID 142421016
methyl 4-amino-3-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethynyl]benzoate (PubChem CID 142421016) has the molecular formula C22H27NO3Si and a molecular weight of 381.55 g/mol. Its IUPAC name is methyl 4-amino-3-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethynyl]benzoate.
| Compound Name | methyl 4-amino-3-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 142421016 |
| Molecular Formula | C22H27NO3Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | methyl 4-amino-3-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(N)c(C#Cc2ccc(O[Si](C)(C)C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C22H27NO3Si/c1-22(2,3)27(5,6)26-19-12-8-16(9-13-19)7-10-17-15-18(21(24)25-4)11-14-20(17)23/h8-9,11-15H,23H2,1-6H3 |
| InChIKey | LBJBTOBVQZKOLP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|