C28H43BrO4Si2 — CID 140840729
methyl 3-[2-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-4-bromobenzoate (PubChem CID 140840729) has the molecular formula C28H43BrO4Si2 and a molecular weight of 579.72 g/mol. Its IUPAC name is methyl 3-[2-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-4-bromobenzoate.
| Compound Name | methyl 3-[2-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-4-bromobenzoate |
|---|---|
| PubChem CID | 140840729 |
| Molecular Formula | C28H43BrO4Si2 |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | methyl 3-[2-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]ethyl]-4-bromobenzoate |
| SMILES | COC(=O)c1ccc(Br)c(CCc2ccc(O[Si](C)(C)C(C)(C)C)cc2O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H43BrO4Si2/c1-27(2,3)34(8,9)32-23-16-14-20(25(19-23)33-35(10,11)28(4,5)6)12-13-21-18-22(26(30)31-7)15-17-24(21)29/h14-19H,12-13H2,1-11H3 |
| InChIKey | OVGRQXKCLLYXLX-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|