C23H32O4Si — CID 154718984
1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2,4-dimethoxyphenyl)propan-1-one (PubChem CID 154718984) has the molecular formula C23H32O4Si and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2,4-dimethoxyphenyl)propan-1-one.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 154718984 |
| Molecular Formula | C23H32O4Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(2,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H32O4Si/c1-23(2,3)28(6,7)27-19-12-8-17(9-13-19)21(24)15-11-18-10-14-20(25-4)16-22(18)26-5/h8-10,12-14,16H,11,15H2,1-7H3 |
| InChIKey | RZEQBVGUIOBPJZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|