C18H28O2Si — CID 146163201
(E)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hex-4-en-1-one (PubChem CID 146163201) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (E)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hex-4-en-1-one.
| Compound Name | (E)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hex-4-en-1-one |
|---|---|
| PubChem CID | 146163201 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (E)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hex-4-en-1-one |
| SMILES | C/C=C/CCC(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O2Si/c1-7-8-9-10-17(19)15-11-13-16(14-12-15)20-21(5,6)18(2,3)4/h7-8,11-14H,9-10H2,1-6H3/b8-7+ |
| InChIKey | ZXTJAQPQXKIZPA-BQYQJAHWSA-N |
| XLogP | 5.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|