C17H29NO2Si — CID 58586309
4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethylbenzamide (PubChem CID 58586309) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethylbenzamide.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 58586309 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO2Si/c1-8-18(9-2)16(19)14-10-12-15(13-11-14)20-21(6,7)17(3,4)5/h10-13H,8-9H2,1-7H3 |
| InChIKey | CJPUCPOWMFGQAV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|