C15H26N3O3P — CID 14791031
4-[bis(dimethylamino)phosphoryloxy]-N,N-diethylbenzamide (PubChem CID 14791031) has the molecular formula C15H26N3O3P and a molecular weight of 327.37 g/mol. Its IUPAC name is 4-[bis(dimethylamino)phosphoryloxy]-N,N-diethylbenzamide.
| Compound Name | 4-[bis(dimethylamino)phosphoryloxy]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 14791031 |
| Molecular Formula | C15H26N3O3P |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-[bis(dimethylamino)phosphoryloxy]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(OP(=O)(N(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C15H26N3O3P/c1-7-18(8-2)15(19)13-9-11-14(12-10-13)21-22(20,16(3)4)17(5)6/h9-12H,7-8H2,1-6H3 |
| InChIKey | SBDGNJGVIDLWLT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|