C23H43NO3Si2 — CID 11419229
2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethylbenzamide (PubChem CID 11419229) has the molecular formula C23H43NO3Si2 and a molecular weight of 437.77 g/mol. Its IUPAC name is 2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethylbenzamide.
| Compound Name | 2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 11419229 |
| Molecular Formula | C23H43NO3Si2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H43NO3Si2/c1-13-24(14-2)21(25)19-16-15-18(26-28(9,10)22(3,4)5)17-20(19)27-29(11,12)23(6,7)8/h15-17H,13-14H2,1-12H3 |
| InChIKey | JGPHSWWIFXVRJN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|