C27H40O3Si — CID 171060871
[2-[tert-butyl(dimethyl)silyl]oxy-4-octoxyphenyl]-phenylmethanone (PubChem CID 171060871) has the molecular formula C27H40O3Si and a molecular weight of 440.70 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-4-octoxyphenyl]-phenylmethanone.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-4-octoxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 171060871 |
| Molecular Formula | C27H40O3Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-4-octoxyphenyl]-phenylmethanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2ccccc2)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C27H40O3Si/c1-7-8-9-10-11-15-20-29-23-18-19-24(26(28)22-16-13-12-14-17-22)25(21-23)30-31(5,6)27(2,3)4/h12-14,16-19,21H,7-11,15,20H2,1-6H3 |
| InChIKey | SYCONIZVBOVRDT-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|