C25H38O3Si2 — CID 91744472
[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-phenylmethanone (PubChem CID 91744472) has the molecular formula C25H38O3Si2 and a molecular weight of 442.75 g/mol. Its IUPAC name is [2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-phenylmethanone.
| Compound Name | [2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 91744472 |
| Molecular Formula | C25H38O3Si2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-phenylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(=O)c2ccccc2)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H38O3Si2/c1-24(2,3)29(7,8)27-20-16-17-21(23(26)19-14-12-11-13-15-19)22(18-20)28-30(9,10)25(4,5)6/h11-18H,1-10H3 |
| InChIKey | KWUFIVDDPOIEIN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|