C26H40O4Si2 — CID 10950821
[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-(4-methoxyphenyl)methanone (PubChem CID 10950821) has the molecular formula C26H40O4Si2 and a molecular weight of 472.77 g/mol. Its IUPAC name is [3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 10950821 |
| Molecular Formula | C26H40O4Si2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C26H40O4Si2/c1-25(2,3)31(8,9)29-22-16-20(24(27)19-12-14-21(28-7)15-13-19)17-23(18-22)30-32(10,11)26(4,5)6/h12-18H,1-11H3 |
| InChIKey | XFHJEDJFFLSWJR-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|